C16H22N2 — CID 107388915
1-cyclohex-2-en-1-yl-3-methyl-2,3,4,5-tetrahydro-1,4-benzodiazepine (PubChem CID 107388915) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 1-cyclohex-2-en-1-yl-3-methyl-2,3,4,5-tetrahydro-1,4-benzodiazepine.
| Compound Name | 1-cyclohex-2-en-1-yl-3-methyl-2,3,4,5-tetrahydro-1,4-benzodiazepine |
|---|---|
| PubChem CID | 107388915 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 1-cyclohex-2-en-1-yl-3-methyl-2,3,4,5-tetrahydro-1,4-benzodiazepine |
| SMILES | CC1CN(C2C=CCCC2)c2ccccc2CN1 |
| InChI | InChI=1S/C16H22N2/c1-13-12-18(15-8-3-2-4-9-15)16-10-6-5-7-14(16)11-17-13/h3,5-8,10,13,15,17H,2,4,9,11-12H2,1H3 |
| InChIKey | WIMWLNKTPCMOIX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|