C24H37NO3 — CID 10738975
2-[(1S,3S)-1-hydroxy-3-[(E)-3-hydroxy-3-methyl-7-phenylhept-1-enyl]cyclohexyl]-N,N-dimethylacetamide (PubChem CID 10738975) has the molecular formula C24H37NO3 and a molecular weight of 387.56 g/mol. Its IUPAC name is 2-[(1S,3S)-1-hydroxy-3-[(E)-3-hydroxy-3-methyl-7-phenylhept-1-enyl]cyclohexyl]-N,N-dimethylacetamide.
| Compound Name | 2-[(1S,3S)-1-hydroxy-3-[(E)-3-hydroxy-3-methyl-7-phenylhept-1-enyl]cyclohexyl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 10738975 |
| Molecular Formula | C24H37NO3 |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | 2-[(1S,3S)-1-hydroxy-3-[(E)-3-hydroxy-3-methyl-7-phenylhept-1-enyl]cyclohexyl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C[C@]1(O)CCC[C@H](/C=C/C(C)(O)CCCCc2ccccc2)C1 |
| InChI | InChI=1S/C24H37NO3/c1-23(27,15-8-7-12-20-10-5-4-6-11-20)17-14-21-13-9-16-24(28,18-21)19-22(26)25(2)3/h4-6,10-11,14,17,21,27-28H,7-9,12-13,15-16,18-19H2,1-3H3/b17-14+/t21-,23?,24+/m1/s1 |
| InChIKey | DYNDZRFWNRTMKY-DQZNHLMFSA-N |
| XLogP | 4.11 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|