C13H24N4O4 — CID 107389812
6-amino-5-(2,2-dimethoxyethylamino)-3-methyl-1-(2-methylpropyl)pyrimidine-2,4-dione (PubChem CID 107389812) has the molecular formula C13H24N4O4 and a molecular weight of 300.36 g/mol. Its IUPAC name is 6-amino-5-(2,2-dimethoxyethylamino)-3-methyl-1-(2-methylpropyl)pyrimidine-2,4-dione.
| Compound Name | 6-amino-5-(2,2-dimethoxyethylamino)-3-methyl-1-(2-methylpropyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 107389812 |
| Molecular Formula | C13H24N4O4 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 6-amino-5-(2,2-dimethoxyethylamino)-3-methyl-1-(2-methylpropyl)pyrimidine-2,4-dione |
| SMILES | COC(CNc1c(N)n(CC(C)C)c(=O)n(C)c1=O)OC |
| InChI | InChI=1S/C13H24N4O4/c1-8(2)7-17-11(14)10(12(18)16(3)13(17)19)15-6-9(20-4)21-5/h8-9,15H,6-7,14H2,1-5H3 |
| InChIKey | CYCKXOUDIPBMFW-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|