About 2-chloro-5-cyano-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]benzenesulfonamide
2-chloro-5-cyano-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]benzenesulfonamide (PubChem CID 107389862) has the molecular formula C13H15ClN2O4S
and a molecular weight of 330.79 g/mol. Its IUPAC name is 2-chloro-5-cyano-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 2-chloro-5-cyano-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]benzenesulfonamide |
| PubChem CID | 107389862 |
| Molecular Formula | C13H15ClN2O4S |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 2-chloro-5-cyano-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]benzenesulfonamide |
| SMILES | CC1(C)OCC(CNS(=O)(=O)c2cc(C#N)ccc2Cl)O1 |
| InChI | InChI=1S/C13H15ClN2O4S/c1-13(2)19-8-10(20-13)7-16-21(17,18)12-5-9(6-15)3-4-11(12)14/h3-5,10,16H,7-8H2,1-2H3 |
| InChIKey | UDVQWVTWDCZEFA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-5-cyano-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-cyano-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]benzenesulfonamide?
The IUPAC name of 2-chloro-5-cyano-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]benzenesulfonamide (CID 107389862) is 2-chloro-5-cyano-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]benzenesulfonamide.
What is the SMILES notation for 2-chloro-5-cyano-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]benzenesulfonamide?
The canonical SMILES for 2-chloro-5-cyano-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]benzenesulfonamide is CC1(C)OCC(CNS(=O)(=O)c2cc(C#N)ccc2Cl)O1.
What is the InChIKey of 2-chloro-5-cyano-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]benzenesulfonamide?
The InChIKey is UDVQWVTWDCZEFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClN2O4S/c1-13(2)19-8-10(20-13)7-16-21(17,18)12-5-9(6-15)3-4-11(12)14/h3-5,10,16H,7-8H2,1-2H3.
What are the key properties of 2-chloro-5-cyano-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]benzenesulfonamide?
2-chloro-5-cyano-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]benzenesulfonamide has a molecular weight of 330.79 g/mol, XLogP of 1.64, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-cyano-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]benzenesulfonamide is sourced from PubChem (CID 107389862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).