About 3-(2,2-dimethoxyethylamino)cyclopent-2-en-1-one
3-(2,2-dimethoxyethylamino)cyclopent-2-en-1-one (PubChem CID 107390055) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is 3-(2,2-dimethoxyethylamino)cyclopent-2-en-1-one.
Molecular Properties
| Compound Name | 3-(2,2-dimethoxyethylamino)cyclopent-2-en-1-one |
| PubChem CID | 107390055 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 3-(2,2-dimethoxyethylamino)cyclopent-2-en-1-one |
| SMILES | COC(CNC1=CC(=O)CC1)OC |
| InChI | InChI=1S/C9H15NO3/c1-12-9(13-2)6-10-7-3-4-8(11)5-7/h5,9-10H,3-4,6H2,1-2H3 |
| InChIKey | JKQZHRFQWCYXPB-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-dimethoxyethylamino)cyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-dimethoxyethylamino)cyclopent-2-en-1-one?
The IUPAC name of 3-(2,2-dimethoxyethylamino)cyclopent-2-en-1-one (CID 107390055) is 3-(2,2-dimethoxyethylamino)cyclopent-2-en-1-one.
What is the SMILES notation for 3-(2,2-dimethoxyethylamino)cyclopent-2-en-1-one?
The canonical SMILES for 3-(2,2-dimethoxyethylamino)cyclopent-2-en-1-one is COC(CNC1=CC(=O)CC1)OC.
What is the InChIKey of 3-(2,2-dimethoxyethylamino)cyclopent-2-en-1-one?
The InChIKey is JKQZHRFQWCYXPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c1-12-9(13-2)6-10-7-3-4-8(11)5-7/h5,9-10H,3-4,6H2,1-2H3.
What are the key properties of 3-(2,2-dimethoxyethylamino)cyclopent-2-en-1-one?
3-(2,2-dimethoxyethylamino)cyclopent-2-en-1-one has a molecular weight of 185.22 g/mol, XLogP of 0.44, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dimethoxyethylamino)cyclopent-2-en-1-one is sourced from PubChem (CID 107390055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).