C6H11N3O2S — CID 107390184
N-(2,2-dimethoxyethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 107390184) has the molecular formula C6H11N3O2S and a molecular weight of 189.24 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(2,2-dimethoxyethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 107390184 |
| Molecular Formula | C6H11N3O2S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | COC(CNc1ncns1)OC |
| InChI | InChI=1S/C6H11N3O2S/c1-10-5(11-2)3-7-6-8-4-9-12-6/h4-5H,3H2,1-2H3,(H,7,8,9) |
| InChIKey | YCSWBPIIANMSMA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|