C13H22N4O2 — CID 107390347
(4-amino-1-ethylpyrazol-3-yl)-(3-methoxy-3-methylpiperidin-1-yl)methanone (PubChem CID 107390347) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is (4-amino-1-ethylpyrazol-3-yl)-(3-methoxy-3-methylpiperidin-1-yl)methanone.
| Compound Name | (4-amino-1-ethylpyrazol-3-yl)-(3-methoxy-3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 107390347 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | (4-amino-1-ethylpyrazol-3-yl)-(3-methoxy-3-methylpiperidin-1-yl)methanone |
| SMILES | CCn1cc(N)c(C(=O)N2CCCC(C)(OC)C2)n1 |
| InChI | InChI=1S/C13H22N4O2/c1-4-17-8-10(14)11(15-17)12(18)16-7-5-6-13(2,9-16)19-3/h8H,4-7,9,14H2,1-3H3 |
| InChIKey | UEPAZPBLMQLDIS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |