C14H21FN2O — CID 107390548
5-fluoro-2-(3-methoxy-3-methylpiperidin-1-yl)-4-methylaniline (PubChem CID 107390548) has the molecular formula C14H21FN2O and a molecular weight of 252.33 g/mol. Its IUPAC name is 5-fluoro-2-(3-methoxy-3-methylpiperidin-1-yl)-4-methylaniline.
| Compound Name | 5-fluoro-2-(3-methoxy-3-methylpiperidin-1-yl)-4-methylaniline |
|---|---|
| PubChem CID | 107390548 |
| Molecular Formula | C14H21FN2O |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 5-fluoro-2-(3-methoxy-3-methylpiperidin-1-yl)-4-methylaniline |
| SMILES | COC1(C)CCCN(c2cc(C)c(F)cc2N)C1 |
| InChI | InChI=1S/C14H21FN2O/c1-10-7-13(12(16)8-11(10)15)17-6-4-5-14(2,9-17)18-3/h7-8H,4-6,9,16H2,1-3H3 |
| InChIKey | IFRLLOGKZMRHJR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|