C15H30N2O2 — CID 107392505
(3S)-3-(aminomethyl)-1-(3-methoxy-3-methylpiperidin-1-yl)-5-methylhexan-1-one (PubChem CID 107392505) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is (3S)-3-(aminomethyl)-1-(3-methoxy-3-methylpiperidin-1-yl)-5-methylhexan-1-one.
| Compound Name | (3S)-3-(aminomethyl)-1-(3-methoxy-3-methylpiperidin-1-yl)-5-methylhexan-1-one |
|---|---|
| PubChem CID | 107392505 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | (3S)-3-(aminomethyl)-1-(3-methoxy-3-methylpiperidin-1-yl)-5-methylhexan-1-one |
| SMILES | COC1(C)CCCN(C(=O)C[C@@H](CN)CC(C)C)C1 |
| InChI | InChI=1S/C15H30N2O2/c1-12(2)8-13(10-16)9-14(18)17-7-5-6-15(3,11-17)19-4/h12-13H,5-11,16H2,1-4H3/t13-,15?/m0/s1 |
| InChIKey | ZEKVPFGPDMEAJC-CFMCSPIPSA-N |
| XLogP | 2.03 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |