About 4-(7-methoxy-9,9-dipropylfluoren-2-yl)-1-methylpiperidin-4-ol
4-(7-methoxy-9,9-dipropylfluoren-2-yl)-1-methylpiperidin-4-ol (PubChem CID 10739357) has the molecular formula C26H35NO2
and a molecular weight of 393.57 g/mol. Its IUPAC name is 4-(7-methoxy-9,9-dipropylfluoren-2-yl)-1-methylpiperidin-4-ol.
Molecular Properties
| Compound Name | 4-(7-methoxy-9,9-dipropylfluoren-2-yl)-1-methylpiperidin-4-ol |
| PubChem CID | 10739357 |
| Molecular Formula | C26H35NO2 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | 4-(7-methoxy-9,9-dipropylfluoren-2-yl)-1-methylpiperidin-4-ol |
| SMILES | CCCC1(CCC)c2cc(OC)ccc2-c2ccc(C3(O)CCN(C)CC3)cc21 |
| InChI | InChI=1S/C26H35NO2/c1-5-11-25(12-6-2)23-17-19(26(28)13-15-27(3)16-14-26)7-9-21(23)22-10-8-20(29-4)18-24(22)25/h7-10,17-18,28H,5-6,11-16H2,1-4H3 |
| InChIKey | ZTRSZTFKQQBBQT-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(7-methoxy-9,9-dipropylfluoren-2-yl)-1-methylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7-methoxy-9,9-dipropylfluoren-2-yl)-1-methylpiperidin-4-ol?
The IUPAC name of 4-(7-methoxy-9,9-dipropylfluoren-2-yl)-1-methylpiperidin-4-ol (CID 10739357) is 4-(7-methoxy-9,9-dipropylfluoren-2-yl)-1-methylpiperidin-4-ol.
What is the SMILES notation for 4-(7-methoxy-9,9-dipropylfluoren-2-yl)-1-methylpiperidin-4-ol?
The canonical SMILES for 4-(7-methoxy-9,9-dipropylfluoren-2-yl)-1-methylpiperidin-4-ol is CCCC1(CCC)c2cc(OC)ccc2-c2ccc(C3(O)CCN(C)CC3)cc21.
What is the InChIKey of 4-(7-methoxy-9,9-dipropylfluoren-2-yl)-1-methylpiperidin-4-ol?
The InChIKey is ZTRSZTFKQQBBQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H35NO2/c1-5-11-25(12-6-2)23-17-19(26(28)13-15-27(3)16-14-26)7-9-21(23)22-10-8-20(29-4)18-24(22)25/h7-10,17-18,28H,5-6,11-16H2,1-4H3.
What are the key properties of 4-(7-methoxy-9,9-dipropylfluoren-2-yl)-1-methylpiperidin-4-ol?
4-(7-methoxy-9,9-dipropylfluoren-2-yl)-1-methylpiperidin-4-ol has a molecular weight of 393.57 g/mol, XLogP of 5.48, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-methoxy-9,9-dipropylfluoren-2-yl)-1-methylpiperidin-4-ol is sourced from PubChem (CID 10739357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).