C13H27NO3 — CID 107393619
1-(2,2-diethoxyethyl)-3-methoxy-3-methylpiperidine (PubChem CID 107393619) has the molecular formula C13H27NO3 and a molecular weight of 245.36 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-3-methoxy-3-methylpiperidine.
| Compound Name | 1-(2,2-diethoxyethyl)-3-methoxy-3-methylpiperidine |
|---|---|
| PubChem CID | 107393619 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-3-methoxy-3-methylpiperidine |
| SMILES | CCOC(CN1CCCC(C)(OC)C1)OCC |
| InChI | InChI=1S/C13H27NO3/c1-5-16-12(17-6-2)10-14-9-7-8-13(3,11-14)15-4/h12H,5-11H2,1-4H3 |
| InChIKey | DHCMGNDCWXWAHN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|