About [(E)-6-azido-3,7-dimethyl-7-phenylselanyloct-2-enyl] acetate
[(E)-6-azido-3,7-dimethyl-7-phenylselanyloct-2-enyl] acetate (PubChem CID 10739382) has the molecular formula C18H25N3O2Se
and a molecular weight of 394.38 g/mol. Its IUPAC name is [(E)-6-azido-3,7-dimethyl-7-phenylselanyloct-2-enyl] acetate.
Molecular Properties
| Compound Name | [(E)-6-azido-3,7-dimethyl-7-phenylselanyloct-2-enyl] acetate |
| PubChem CID | 10739382 |
| Molecular Formula | C18H25N3O2Se |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | [(E)-6-azido-3,7-dimethyl-7-phenylselanyloct-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CCC(N=[N+]=[N-])C(C)(C)[Se]c1ccccc1 |
| InChI | InChI=1S/C18H25N3O2Se/c1-14(12-13-23-15(2)22)10-11-17(20-21-19)18(3,4)24-16-8-6-5-7-9-16/h5-9,12,17H,10-11,13H2,1-4H3/b14-12+ |
| InChIKey | ITXGCAZSLQRXJJ-WYMLVPIESA-N |
| XLogP | 4.18 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-6-azido-3,7-dimethyl-7-phenylselanyloct-2-enyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-6-azido-3,7-dimethyl-7-phenylselanyloct-2-enyl] acetate?
The IUPAC name of [(E)-6-azido-3,7-dimethyl-7-phenylselanyloct-2-enyl] acetate (CID 10739382) is [(E)-6-azido-3,7-dimethyl-7-phenylselanyloct-2-enyl] acetate.
What is the SMILES notation for [(E)-6-azido-3,7-dimethyl-7-phenylselanyloct-2-enyl] acetate?
The canonical SMILES for [(E)-6-azido-3,7-dimethyl-7-phenylselanyloct-2-enyl] acetate is CC(=O)OC/C=C(\C)CCC(N=[N+]=[N-])C(C)(C)[Se]c1ccccc1.
What is the InChIKey of [(E)-6-azido-3,7-dimethyl-7-phenylselanyloct-2-enyl] acetate?
The InChIKey is ITXGCAZSLQRXJJ-WYMLVPIESA-N. The full InChI is InChI=1S/C18H25N3O2Se/c1-14(12-13-23-15(2)22)10-11-17(20-21-19)18(3,4)24-16-8-6-5-7-9-16/h5-9,12,17H,10-11,13H2,1-4H3/b14-12+.
What are the key properties of [(E)-6-azido-3,7-dimethyl-7-phenylselanyloct-2-enyl] acetate?
[(E)-6-azido-3,7-dimethyl-7-phenylselanyloct-2-enyl] acetate has a molecular weight of 394.38 g/mol, XLogP of 4.18, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-6-azido-3,7-dimethyl-7-phenylselanyloct-2-enyl] acetate is sourced from PubChem (CID 10739382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).