About N-[2-[3,5-dichloro-2-(2-phenylethoxy)phenyl]ethyl]-N-propylpropan-1-amine
N-[2-[3,5-dichloro-2-(2-phenylethoxy)phenyl]ethyl]-N-propylpropan-1-amine (PubChem CID 10739385) has the molecular formula C22H29Cl2NO
and a molecular weight of 394.39 g/mol. Its IUPAC name is N-[2-[3,5-dichloro-2-(2-phenylethoxy)phenyl]ethyl]-N-propylpropan-1-amine.
Molecular Properties
| Compound Name | N-[2-[3,5-dichloro-2-(2-phenylethoxy)phenyl]ethyl]-N-propylpropan-1-amine |
| PubChem CID | 10739385 |
| Molecular Formula | C22H29Cl2NO |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | N-[2-[3,5-dichloro-2-(2-phenylethoxy)phenyl]ethyl]-N-propylpropan-1-amine |
| SMILES | CCCN(CCC)CCc1cc(Cl)cc(Cl)c1OCCc1ccccc1 |
| InChI | InChI=1S/C22H29Cl2NO/c1-3-12-25(13-4-2)14-10-19-16-20(23)17-21(24)22(19)26-15-11-18-8-6-5-7-9-18/h5-9,16-17H,3-4,10-15H2,1-2H3 |
| InChIKey | OUPQTYHOIFANCC-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-[3,5-dichloro-2-(2-phenylethoxy)phenyl]ethyl]-N-propylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[3,5-dichloro-2-(2-phenylethoxy)phenyl]ethyl]-N-propylpropan-1-amine?
The IUPAC name of N-[2-[3,5-dichloro-2-(2-phenylethoxy)phenyl]ethyl]-N-propylpropan-1-amine (CID 10739385) is N-[2-[3,5-dichloro-2-(2-phenylethoxy)phenyl]ethyl]-N-propylpropan-1-amine.
What is the SMILES notation for N-[2-[3,5-dichloro-2-(2-phenylethoxy)phenyl]ethyl]-N-propylpropan-1-amine?
The canonical SMILES for N-[2-[3,5-dichloro-2-(2-phenylethoxy)phenyl]ethyl]-N-propylpropan-1-amine is CCCN(CCC)CCc1cc(Cl)cc(Cl)c1OCCc1ccccc1.
What is the InChIKey of N-[2-[3,5-dichloro-2-(2-phenylethoxy)phenyl]ethyl]-N-propylpropan-1-amine?
The InChIKey is OUPQTYHOIFANCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29Cl2NO/c1-3-12-25(13-4-2)14-10-19-16-20(23)17-21(24)22(19)26-15-11-18-8-6-5-7-9-18/h5-9,16-17H,3-4,10-15H2,1-2H3.
What are the key properties of N-[2-[3,5-dichloro-2-(2-phenylethoxy)phenyl]ethyl]-N-propylpropan-1-amine?
N-[2-[3,5-dichloro-2-(2-phenylethoxy)phenyl]ethyl]-N-propylpropan-1-amine has a molecular weight of 394.39 g/mol, XLogP of 6.28, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[3,5-dichloro-2-(2-phenylethoxy)phenyl]ethyl]-N-propylpropan-1-amine is sourced from PubChem (CID 10739385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).