C16H27N3O — CID 107394997
3-[(3-methoxy-3-methylpiperidin-1-yl)methyl]-N-propylpyridin-2-amine (PubChem CID 107394997) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is 3-[(3-methoxy-3-methylpiperidin-1-yl)methyl]-N-propylpyridin-2-amine.
| Compound Name | 3-[(3-methoxy-3-methylpiperidin-1-yl)methyl]-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 107394997 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 3-[(3-methoxy-3-methylpiperidin-1-yl)methyl]-N-propylpyridin-2-amine |
| SMILES | CCCNc1ncccc1CN1CCCC(C)(OC)C1 |
| InChI | InChI=1S/C16H27N3O/c1-4-9-17-15-14(7-5-10-18-15)12-19-11-6-8-16(2,13-19)20-3/h5,7,10H,4,6,8-9,11-13H2,1-3H3,(H,17,18) |
| InChIKey | WNGIYIHXQWTCAA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |