C21H32O5S — CID 10739542
[(2S)-2-[(1S,2R,5S)-2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)cyclohexyl]propyl] 4-methylbenzenesulfonate (PubChem CID 10739542) has the molecular formula C21H32O5S and a molecular weight of 396.55 g/mol. Its IUPAC name is [(2S)-2-[(1S,2R,5S)-2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)cyclohexyl]propyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-2-[(1S,2R,5S)-2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)cyclohexyl]propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10739542 |
| Molecular Formula | C21H32O5S |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | [(2S)-2-[(1S,2R,5S)-2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)cyclohexyl]propyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](C)[C@H]2C[C@@H](C3(C)OCCO3)CC[C@H]2C)cc1 |
| InChI | InChI=1S/C21H32O5S/c1-15-5-9-19(10-6-15)27(22,23)26-14-17(3)20-13-18(8-7-16(20)2)21(4)24-11-12-25-21/h5-6,9-10,16-18,20H,7-8,11-14H2,1-4H3/t16-,17-,18+,20+/m1/s1 |
| InChIKey | SWYIIGLGQLBTFM-XSYGEPLQSA-N |
| XLogP | 4.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|