About [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] decanoate
[(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] decanoate (PubChem CID 10739554) has the molecular formula C23H44O3Si
and a molecular weight of 396.69 g/mol. Its IUPAC name is [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] decanoate.
Molecular Properties
| Compound Name | [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] decanoate |
| PubChem CID | 10739554 |
| Molecular Formula | C23H44O3Si |
| Molecular Weight | 396.69 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)O[C@@H]1CC=C[C@@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O3Si/c1-7-8-9-10-11-12-13-17-22(24)26-21-16-14-15-20(21)18-19-25-27(5,6)23(2,3)4/h14-15,20-21H,7-13,16-19H2,1-6H3/t20-,21-/m1/s1 |
| InChIKey | GGERXCSARGOUQG-NHCUHLMSSA-N |
| XLogP | 7.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.69 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] decanoate?
The IUPAC name of [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] decanoate (CID 10739554) is [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] decanoate.
What is the SMILES notation for [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] decanoate?
The canonical SMILES for [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] decanoate is CCCCCCCCCC(=O)O[C@@H]1CC=C[C@@H]1CCO[Si](C)(C)C(C)(C)C.
What is the InChIKey of [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] decanoate?
The InChIKey is GGERXCSARGOUQG-NHCUHLMSSA-N. The full InChI is InChI=1S/C23H44O3Si/c1-7-8-9-10-11-12-13-17-22(24)26-21-16-14-15-20(21)18-19-25-27(5,6)23(2,3)4/h14-15,20-21H,7-13,16-19H2,1-6H3/t20-,21-/m1/s1.
What are the key properties of [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] decanoate?
[(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] decanoate has a molecular weight of 396.69 g/mol, XLogP of 7.03, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopent-3-en-1-yl] decanoate is sourced from PubChem (CID 10739554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).