C16H26N2O2 — CID 107395572
N-[[5-[(3-methoxy-3-methylpiperidin-1-yl)methyl]furan-3-yl]methyl]cyclopropanamine (PubChem CID 107395572) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N-[[5-[(3-methoxy-3-methylpiperidin-1-yl)methyl]furan-3-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-[(3-methoxy-3-methylpiperidin-1-yl)methyl]furan-3-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 107395572 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | N-[[5-[(3-methoxy-3-methylpiperidin-1-yl)methyl]furan-3-yl]methyl]cyclopropanamine |
| SMILES | COC1(C)CCCN(Cc2cc(CNC3CC3)co2)C1 |
| InChI | InChI=1S/C16H26N2O2/c1-16(19-2)6-3-7-18(12-16)10-15-8-13(11-20-15)9-17-14-4-5-14/h8,11,14,17H,3-7,9-10,12H2,1-2H3 |
| InChIKey | HKGITTZFYBBLKZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |