C15H22ClNO3S — CID 107396129
1-[[3-(chloromethyl)phenyl]methylsulfonyl]-3-methoxy-3-methylpiperidine (PubChem CID 107396129) has the molecular formula C15H22ClNO3S and a molecular weight of 331.87 g/mol. Its IUPAC name is 1-[[3-(chloromethyl)phenyl]methylsulfonyl]-3-methoxy-3-methylpiperidine.
| Compound Name | 1-[[3-(chloromethyl)phenyl]methylsulfonyl]-3-methoxy-3-methylpiperidine |
|---|---|
| PubChem CID | 107396129 |
| Molecular Formula | C15H22ClNO3S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 1-[[3-(chloromethyl)phenyl]methylsulfonyl]-3-methoxy-3-methylpiperidine |
| SMILES | COC1(C)CCCN(S(=O)(=O)Cc2cccc(CCl)c2)C1 |
| InChI | InChI=1S/C15H22ClNO3S/c1-15(20-2)7-4-8-17(12-15)21(18,19)11-14-6-3-5-13(9-14)10-16/h3,5-6,9H,4,7-8,10-12H2,1-2H3 |
| InChIKey | NBNSCJGIURSTBP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|