C22H25NO6 — CID 10739699
[3-amino-6,7-dimethoxy-1-(3,4,5-trimethoxyphenyl)naphthalen-2-yl]methanol (PubChem CID 10739699) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is [3-amino-6,7-dimethoxy-1-(3,4,5-trimethoxyphenyl)naphthalen-2-yl]methanol.
| Compound Name | [3-amino-6,7-dimethoxy-1-(3,4,5-trimethoxyphenyl)naphthalen-2-yl]methanol |
|---|---|
| PubChem CID | 10739699 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | [3-amino-6,7-dimethoxy-1-(3,4,5-trimethoxyphenyl)naphthalen-2-yl]methanol |
| SMILES | COc1cc2cc(N)c(CO)c(-c3cc(OC)c(OC)c(OC)c3)c2cc1OC |
| InChI | InChI=1S/C22H25NO6/c1-25-17-7-12-6-16(23)15(11-24)21(14(12)10-18(17)26-2)13-8-19(27-3)22(29-5)20(9-13)28-4/h6-10,24H,11,23H2,1-5H3 |
| InChIKey | YFYSVBXOCRLWBC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|