C10H17F3N2O — CID 107397930
1-(cyclobutylmethyl)-1-ethyl-3-(2,2,2-trifluoroethyl)urea (PubChem CID 107397930) has the molecular formula C10H17F3N2O and a molecular weight of 238.25 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-1-ethyl-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(cyclobutylmethyl)-1-ethyl-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 107397930 |
| Molecular Formula | C10H17F3N2O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 1-(cyclobutylmethyl)-1-ethyl-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CCN(CC1CCC1)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O/c1-2-15(6-8-4-3-5-8)9(16)14-7-10(11,12)13/h8H,2-7H2,1H3,(H,14,16) |
| InChIKey | XAYRBPDHSJTXQV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |