C25H27N3O2 — CID 10739816
ethyl (2S)-2-[[(1R,2E)-1,2-diphenyl-2-(phenylhydrazinylidene)ethyl]amino]propanoate (PubChem CID 10739816) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is ethyl (2S)-2-[[(1R,2E)-1,2-diphenyl-2-(phenylhydrazinylidene)ethyl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[(1R,2E)-1,2-diphenyl-2-(phenylhydrazinylidene)ethyl]amino]propanoate |
|---|---|
| PubChem CID | 10739816 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | ethyl (2S)-2-[[(1R,2E)-1,2-diphenyl-2-(phenylhydrazinylidene)ethyl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)N[C@@H](/C(=N/Nc1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27N3O2/c1-3-30-25(29)19(2)26-23(20-13-7-4-8-14-20)24(21-15-9-5-10-16-21)28-27-22-17-11-6-12-18-22/h4-19,23,26-27H,3H2,1-2H3/b28-24+/t19-,23+/m0/s1 |
| InChIKey | CHFHALKBMUFVGK-NMOHFORNSA-N |
| XLogP | 4.79 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|