C17H20N2O2 — CID 107399143
1-[cyclobutylmethyl(ethyl)amino]isoquinoline-3-carboxylic acid (PubChem CID 107399143) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-[cyclobutylmethyl(ethyl)amino]isoquinoline-3-carboxylic acid.
| Compound Name | 1-[cyclobutylmethyl(ethyl)amino]isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 107399143 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-[cyclobutylmethyl(ethyl)amino]isoquinoline-3-carboxylic acid |
| SMILES | CCN(CC1CCC1)c1nc(C(=O)O)cc2ccccc12 |
| InChI | InChI=1S/C17H20N2O2/c1-2-19(11-12-6-5-7-12)16-14-9-4-3-8-13(14)10-15(18-16)17(20)21/h3-4,8-10,12H,2,5-7,11H2,1H3,(H,20,21) |
| InChIKey | PFNRMTHOPHSMFI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |