C17H25IO3 — CID 10739951
(1S,3S)-5-iodo-1,3-dimethyl-6,8-di(propan-2-yloxy)-3,4-dihydro-1H-isochromene (PubChem CID 10739951) has the molecular formula C17H25IO3 and a molecular weight of 404.29 g/mol. Its IUPAC name is (1S,3S)-5-iodo-1,3-dimethyl-6,8-di(propan-2-yloxy)-3,4-dihydro-1H-isochromene.
| Compound Name | (1S,3S)-5-iodo-1,3-dimethyl-6,8-di(propan-2-yloxy)-3,4-dihydro-1H-isochromene |
|---|---|
| PubChem CID | 10739951 |
| Molecular Formula | C17H25IO3 |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | (1S,3S)-5-iodo-1,3-dimethyl-6,8-di(propan-2-yloxy)-3,4-dihydro-1H-isochromene |
| SMILES | CC(C)Oc1cc(OC(C)C)c2c(c1I)C[C@H](C)O[C@H]2C |
| InChI | InChI=1S/C17H25IO3/c1-9(2)19-14-8-15(20-10(3)4)17(18)13-7-11(5)21-12(6)16(13)14/h8-12H,7H2,1-6H3/t11-,12-/m0/s1 |
| InChIKey | JZLZDYBNFDJCQZ-RYUDHWBXSA-N |
| XLogP | 4.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|