C12H20N4O2S — CID 107399525
N-(cyclobutylmethyl)-N-ethyl-4-hydrazinylpyridine-3-sulfonamide (PubChem CID 107399525) has the molecular formula C12H20N4O2S and a molecular weight of 284.38 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-N-ethyl-4-hydrazinylpyridine-3-sulfonamide.
| Compound Name | N-(cyclobutylmethyl)-N-ethyl-4-hydrazinylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 107399525 |
| Molecular Formula | C12H20N4O2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | N-(cyclobutylmethyl)-N-ethyl-4-hydrazinylpyridine-3-sulfonamide |
| SMILES | CCN(CC1CCC1)S(=O)(=O)c1cnccc1NN |
| InChI | InChI=1S/C12H20N4O2S/c1-2-16(9-10-4-3-5-10)19(17,18)12-8-14-7-6-11(12)15-13/h6-8,10H,2-5,9,13H2,1H3,(H,14,15) |
| InChIKey | IVAVTSWPABPBOF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|