C15H20F3NO — CID 107399684
[4-[cyclobutylmethyl(ethyl)amino]-2-(trifluoromethyl)phenyl]methanol (PubChem CID 107399684) has the molecular formula C15H20F3NO and a molecular weight of 287.32 g/mol. Its IUPAC name is [4-[cyclobutylmethyl(ethyl)amino]-2-(trifluoromethyl)phenyl]methanol.
| Compound Name | [4-[cyclobutylmethyl(ethyl)amino]-2-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 107399684 |
| Molecular Formula | C15H20F3NO |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | [4-[cyclobutylmethyl(ethyl)amino]-2-(trifluoromethyl)phenyl]methanol |
| SMILES | CCN(CC1CCC1)c1ccc(CO)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H20F3NO/c1-2-19(9-11-4-3-5-11)13-7-6-12(10-20)14(8-13)15(16,17)18/h6-8,11,20H,2-5,9-10H2,1H3 |
| InChIKey | YTXFGGPVMJAPCE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|