C11H16BrNO2S2 — CID 107400610
3-bromo-N-(cyclobutylmethyl)-N-ethylthiophene-2-sulfonamide (PubChem CID 107400610) has the molecular formula C11H16BrNO2S2 and a molecular weight of 338.29 g/mol. Its IUPAC name is 3-bromo-N-(cyclobutylmethyl)-N-ethylthiophene-2-sulfonamide.
| Compound Name | 3-bromo-N-(cyclobutylmethyl)-N-ethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 107400610 |
| Molecular Formula | C11H16BrNO2S2 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | 3-bromo-N-(cyclobutylmethyl)-N-ethylthiophene-2-sulfonamide |
| SMILES | CCN(CC1CCC1)S(=O)(=O)c1sccc1Br |
| InChI | InChI=1S/C11H16BrNO2S2/c1-2-13(8-9-4-3-5-9)17(14,15)11-10(12)6-7-16-11/h6-7,9H,2-5,8H2,1H3 |
| InChIKey | HGRAFENBILQNSC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |