C26H34N2O2 — CID 10740121
4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-2-phenyl-1,4-benzoxazin-3-one (PubChem CID 10740121) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is 4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-2-phenyl-1,4-benzoxazin-3-one.
| Compound Name | 4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-2-phenyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 10740121 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 4-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]-2-phenyl-1,4-benzoxazin-3-one |
| SMILES | C[C@@H]1CCC[C@H](C)N1CCCCCN1C(=O)C(c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C26H34N2O2/c1-20-12-11-13-21(2)27(20)18-9-4-10-19-28-23-16-7-8-17-24(23)30-25(26(28)29)22-14-5-3-6-15-22/h3,5-8,14-17,20-21,25H,4,9-13,18-19H2,1-2H3/t20-,21+,25? |
| InChIKey | BWAAOARPNKBGHD-KEVCNVLYSA-N |
| XLogP | 5.59 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|