C19H42O5Si2 — CID 10740131
(Z,2S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-6-(2-trimethylsilylethoxymethoxy)hept-4-ene-1,2-diol (PubChem CID 10740131) has the molecular formula C19H42O5Si2 and a molecular weight of 406.71 g/mol. Its IUPAC name is (Z,2S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-6-(2-trimethylsilylethoxymethoxy)hept-4-ene-1,2-diol.
| Compound Name | (Z,2S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-6-(2-trimethylsilylethoxymethoxy)hept-4-ene-1,2-diol |
|---|---|
| PubChem CID | 10740131 |
| Molecular Formula | C19H42O5Si2 |
| Molecular Weight | 406.71 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | (Z,2S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-6-(2-trimethylsilylethoxymethoxy)hept-4-ene-1,2-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](/C=C\C[C@H](O)CO)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C19H42O5Si2/c1-19(2,3)26(7,8)24-15-18(11-9-10-17(21)14-20)23-16-22-12-13-25(4,5)6/h9,11,17-18,20-21H,10,12-16H2,1-8H3/b11-9-/t17-,18-/m0/s1 |
| InChIKey | UNBXRALBFQRWDT-QOVPWNHXSA-N |
| XLogP | 4.01 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.71 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|