C24H25FN2O3 — CID 10740213
2-[[4-[4-(4-fluorophenyl)-4-oxobutyl]piperazin-1-yl]methyl]chromen-4-one (PubChem CID 10740213) has the molecular formula C24H25FN2O3 and a molecular weight of 408.47 g/mol. Its IUPAC name is 2-[[4-[4-(4-fluorophenyl)-4-oxobutyl]piperazin-1-yl]methyl]chromen-4-one.
| Compound Name | 2-[[4-[4-(4-fluorophenyl)-4-oxobutyl]piperazin-1-yl]methyl]chromen-4-one |
|---|---|
| PubChem CID | 10740213 |
| Molecular Formula | C24H25FN2O3 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 2-[[4-[4-(4-fluorophenyl)-4-oxobutyl]piperazin-1-yl]methyl]chromen-4-one |
| SMILES | O=C(CCCN1CCN(Cc2cc(=O)c3ccccc3o2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H25FN2O3/c25-19-9-7-18(8-10-19)22(28)5-3-11-26-12-14-27(15-13-26)17-20-16-23(29)21-4-1-2-6-24(21)30-20/h1-2,4,6-10,16H,3,5,11-15,17H2 |
| InChIKey | FBSSLFYIRVICCU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |