C21H20N4O3S — CID 10740217
7-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methoxy]-3-phenyl-4-propylchromen-2-one (PubChem CID 10740217) has the molecular formula C21H20N4O3S and a molecular weight of 408.48 g/mol. Its IUPAC name is 7-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methoxy]-3-phenyl-4-propylchromen-2-one.
| Compound Name | 7-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methoxy]-3-phenyl-4-propylchromen-2-one |
|---|---|
| PubChem CID | 10740217 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 7-[(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methoxy]-3-phenyl-4-propylchromen-2-one |
| SMILES | CCCc1c(-c2ccccc2)c(=O)oc2cc(OCc3n[nH]c(=S)n3N)ccc12 |
| InChI | InChI=1S/C21H20N4O3S/c1-2-6-16-15-10-9-14(27-12-18-23-24-21(29)25(18)22)11-17(15)28-20(26)19(16)13-7-4-3-5-8-13/h3-5,7-11H,2,6,12,22H2,1H3,(H,24,29) |
| InChIKey | UKQMLJLAWRJDSH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|