C16H24ClNO2S — CID 107402746
4-(3-chloropropyl)-N-(cyclobutylmethyl)-N-ethylbenzenesulfonamide (PubChem CID 107402746) has the molecular formula C16H24ClNO2S and a molecular weight of 329.89 g/mol. Its IUPAC name is 4-(3-chloropropyl)-N-(cyclobutylmethyl)-N-ethylbenzenesulfonamide.
| Compound Name | 4-(3-chloropropyl)-N-(cyclobutylmethyl)-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107402746 |
| Molecular Formula | C16H24ClNO2S |
| Molecular Weight | 329.89 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 4-(3-chloropropyl)-N-(cyclobutylmethyl)-N-ethylbenzenesulfonamide |
| SMILES | CCN(CC1CCC1)S(=O)(=O)c1ccc(CCCCl)cc1 |
| InChI | InChI=1S/C16H24ClNO2S/c1-2-18(13-15-5-3-6-15)21(19,20)16-10-8-14(9-11-16)7-4-12-17/h8-11,15H,2-7,12-13H2,1H3 |
| InChIKey | DLDCZJUQFPNFSV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.89 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|