C12H18F3N5 — CID 107403230
N-(cyclobutylmethyl)-N-ethyl-6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 107403230) has the molecular formula C12H18F3N5 and a molecular weight of 289.31 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-N-ethyl-6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-(cyclobutylmethyl)-N-ethyl-6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 107403230 |
| Molecular Formula | C12H18F3N5 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | N-(cyclobutylmethyl)-N-ethyl-6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CCN(CC1CCC1)c1cc(NN)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H18F3N5/c1-2-20(7-8-4-3-5-8)10-6-9(19-16)17-11(18-10)12(13,14)15/h6,8H,2-5,7,16H2,1H3,(H,17,18,19) |
| InChIKey | XYAUFNANOBNRCZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|