C12H25N3O — CID 107404841
5-(4-hydroxy-4-methylazepan-1-yl)pentanimidamide (PubChem CID 107404841) has the molecular formula C12H25N3O and a molecular weight of 227.35 g/mol. Its IUPAC name is 5-(4-hydroxy-4-methylazepan-1-yl)pentanimidamide.
| Compound Name | 5-(4-hydroxy-4-methylazepan-1-yl)pentanimidamide |
|---|---|
| PubChem CID | 107404841 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | 5-(4-hydroxy-4-methylazepan-1-yl)pentanimidamide |
| SMILES | [H]/N=C(\N)CCCCN1CCCC(C)(O)CC1 |
| InChI | InChI=1S/C12H25N3O/c1-12(16)6-4-9-15(10-7-12)8-3-2-5-11(13)14/h16H,2-10H2,1H3,(H3,13,14) |
| InChIKey | XRWMRDPYXMATPG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|