C15H17BrN2O3 — CID 107404952
5-bromo-6-(4-hydroxy-4-methylazepan-1-yl)-1H-indole-2,3-dione (PubChem CID 107404952) has the molecular formula C15H17BrN2O3 and a molecular weight of 353.22 g/mol. Its IUPAC name is 5-bromo-6-(4-hydroxy-4-methylazepan-1-yl)-1H-indole-2,3-dione.
| Compound Name | 5-bromo-6-(4-hydroxy-4-methylazepan-1-yl)-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 107404952 |
| Molecular Formula | C15H17BrN2O3 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 5-bromo-6-(4-hydroxy-4-methylazepan-1-yl)-1H-indole-2,3-dione |
| SMILES | CC1(O)CCCN(c2cc3c(cc2Br)C(=O)C(=O)N3)CC1 |
| InChI | InChI=1S/C15H17BrN2O3/c1-15(21)3-2-5-18(6-4-15)12-8-11-9(7-10(12)16)13(19)14(20)17-11/h7-8,21H,2-6H2,1H3,(H,17,19,20) |
| InChIKey | VIDZONBRZWXLTH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|