C25H37NO4 — CID 10740590
tert-butyl N-benzyl-N-[(1S)-3-methyl-1-[(2S,4R)-4-(2-methylprop-2-enyl)-5-oxooxolan-2-yl]butyl]carbamate (PubChem CID 10740590) has the molecular formula C25H37NO4 and a molecular weight of 415.57 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[(1S)-3-methyl-1-[(2S,4R)-4-(2-methylprop-2-enyl)-5-oxooxolan-2-yl]butyl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[(1S)-3-methyl-1-[(2S,4R)-4-(2-methylprop-2-enyl)-5-oxooxolan-2-yl]butyl]carbamate |
|---|---|
| PubChem CID | 10740590 |
| Molecular Formula | C25H37NO4 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | tert-butyl N-benzyl-N-[(1S)-3-methyl-1-[(2S,4R)-4-(2-methylprop-2-enyl)-5-oxooxolan-2-yl]butyl]carbamate |
| SMILES | C=C(C)C[C@@H]1C[C@@H]([C@H](CC(C)C)N(Cc2ccccc2)C(=O)OC(C)(C)C)OC1=O |
| InChI | InChI=1S/C25H37NO4/c1-17(2)13-20-15-22(29-23(20)27)21(14-18(3)4)26(24(28)30-25(5,6)7)16-19-11-9-8-10-12-19/h8-12,18,20-22H,1,13-16H2,2-7H3/t20-,21+,22+/m1/s1 |
| InChIKey | XMISPJAZTPCISA-FSSWDIPSSA-N |
| XLogP | 5.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|