About 2-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]but-2-ynyl]isoindole-1,3-dione
2-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]but-2-ynyl]isoindole-1,3-dione (PubChem CID 10740625) has the molecular formula C23H20N4O2S
and a molecular weight of 416.51 g/mol. Its IUPAC name is 2-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]but-2-ynyl]isoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]but-2-ynyl]isoindole-1,3-dione |
| PubChem CID | 10740625 |
| Molecular Formula | C23H20N4O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]but-2-ynyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC#CCN1CCN(c2nsc3ccccc23)CC1 |
| InChI | InChI=1S/C23H20N4O2S/c28-22-17-7-1-2-8-18(17)23(29)27(22)12-6-5-11-25-13-15-26(16-14-25)21-19-9-3-4-10-20(19)30-24-21/h1-4,7-10H,11-16H2 |
| InChIKey | LFDFDERYUSRWCV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]but-2-ynyl]isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]but-2-ynyl]isoindole-1,3-dione?
The IUPAC name of 2-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]but-2-ynyl]isoindole-1,3-dione (CID 10740625) is 2-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]but-2-ynyl]isoindole-1,3-dione.
What is the SMILES notation for 2-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]but-2-ynyl]isoindole-1,3-dione?
The canonical SMILES for 2-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]but-2-ynyl]isoindole-1,3-dione is O=C1c2ccccc2C(=O)N1CC#CCN1CCN(c2nsc3ccccc23)CC1.
What is the InChIKey of 2-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]but-2-ynyl]isoindole-1,3-dione?
The InChIKey is LFDFDERYUSRWCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N4O2S/c28-22-17-7-1-2-8-18(17)23(29)27(22)12-6-5-11-25-13-15-26(16-14-25)21-19-9-3-4-10-20(19)30-24-21/h1-4,7-10H,11-16H2.
What are the key properties of 2-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]but-2-ynyl]isoindole-1,3-dione?
2-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]but-2-ynyl]isoindole-1,3-dione has a molecular weight of 416.51 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]but-2-ynyl]isoindole-1,3-dione is sourced from PubChem (CID 10740625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).