C14H20N4O2S — CID 107406911
3-amino-2,5-diethyl-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide (PubChem CID 107406911) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 3-amino-2,5-diethyl-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide.
| Compound Name | 3-amino-2,5-diethyl-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 107406911 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 3-amino-2,5-diethyl-N-(4-methyl-1H-pyrazol-5-yl)benzenesulfonamide |
| SMILES | CCc1cc(N)c(CC)c(S(=O)(=O)Nc2[nH]ncc2C)c1 |
| InChI | InChI=1S/C14H20N4O2S/c1-4-10-6-12(15)11(5-2)13(7-10)21(19,20)18-14-9(3)8-16-17-14/h6-8H,4-5,15H2,1-3H3,(H2,16,17,18) |
| InChIKey | KZYHVALGBFDFLB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|