About 4-methyl-1-(4,4,4-trifluorobutylsulfonyl)azepan-4-ol
4-methyl-1-(4,4,4-trifluorobutylsulfonyl)azepan-4-ol (PubChem CID 107406994) has the molecular formula C11H20F3NO3S
and a molecular weight of 303.35 g/mol. Its IUPAC name is 4-methyl-1-(4,4,4-trifluorobutylsulfonyl)azepan-4-ol.
Molecular Properties
| Compound Name | 4-methyl-1-(4,4,4-trifluorobutylsulfonyl)azepan-4-ol |
| PubChem CID | 107406994 |
| Molecular Formula | C11H20F3NO3S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 4-methyl-1-(4,4,4-trifluorobutylsulfonyl)azepan-4-ol |
| SMILES | CC1(O)CCCN(S(=O)(=O)CCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H20F3NO3S/c1-10(16)4-2-7-15(8-6-10)19(17,18)9-3-5-11(12,13)14/h16H,2-9H2,1H3 |
| InChIKey | XFSOBAQNBWPDOR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-1-(4,4,4-trifluorobutylsulfonyl)azepan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-(4,4,4-trifluorobutylsulfonyl)azepan-4-ol?
The IUPAC name of 4-methyl-1-(4,4,4-trifluorobutylsulfonyl)azepan-4-ol (CID 107406994) is 4-methyl-1-(4,4,4-trifluorobutylsulfonyl)azepan-4-ol.
What is the SMILES notation for 4-methyl-1-(4,4,4-trifluorobutylsulfonyl)azepan-4-ol?
The canonical SMILES for 4-methyl-1-(4,4,4-trifluorobutylsulfonyl)azepan-4-ol is CC1(O)CCCN(S(=O)(=O)CCCC(F)(F)F)CC1.
What is the InChIKey of 4-methyl-1-(4,4,4-trifluorobutylsulfonyl)azepan-4-ol?
The InChIKey is XFSOBAQNBWPDOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F3NO3S/c1-10(16)4-2-7-15(8-6-10)19(17,18)9-3-5-11(12,13)14/h16H,2-9H2,1H3.
What are the key properties of 4-methyl-1-(4,4,4-trifluorobutylsulfonyl)azepan-4-ol?
4-methyl-1-(4,4,4-trifluorobutylsulfonyl)azepan-4-ol has a molecular weight of 303.35 g/mol, XLogP of 1.90, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-(4,4,4-trifluorobutylsulfonyl)azepan-4-ol is sourced from PubChem (CID 107406994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).