C14H18F3NO — CID 107407391
4-methyl-1-[2-(trifluoromethyl)phenyl]azepan-4-ol (PubChem CID 107407391) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is 4-methyl-1-[2-(trifluoromethyl)phenyl]azepan-4-ol.
| Compound Name | 4-methyl-1-[2-(trifluoromethyl)phenyl]azepan-4-ol |
|---|---|
| PubChem CID | 107407391 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 4-methyl-1-[2-(trifluoromethyl)phenyl]azepan-4-ol |
| SMILES | CC1(O)CCCN(c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H18F3NO/c1-13(19)7-4-9-18(10-8-13)12-6-3-2-5-11(12)14(15,16)17/h2-3,5-6,19H,4,7-10H2,1H3 |
| InChIKey | QRIPOBYBUYZDNH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |