C21H13N3OS3 — CID 10740779
2-(furan-2-yl)-10-thia-5,7,12-triazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),12,14,16,18-heptaene-6,8-dithione (PubChem CID 10740779) has the molecular formula C21H13N3OS3 and a molecular weight of 419.56 g/mol. Its IUPAC name is 2-(furan-2-yl)-10-thia-5,7,12-triazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),12,14,16,18-heptaene-6,8-dithione.
| Compound Name | 2-(furan-2-yl)-10-thia-5,7,12-triazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),12,14,16,18-heptaene-6,8-dithione |
|---|---|
| PubChem CID | 10740779 |
| Molecular Formula | C21H13N3OS3 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | 2-(furan-2-yl)-10-thia-5,7,12-triazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),12,14,16,18-heptaene-6,8-dithione |
| SMILES | S=c1[nH]c(=S)c2sc3nc4c(c(-c5ccco5)c3c2[nH]1)CCc1ccccc1-4 |
| InChI | InChI=1S/C21H13N3OS3/c26-19-18-17(23-21(27)24-19)15-14(13-6-3-9-25-13)12-8-7-10-4-1-2-5-11(10)16(12)22-20(15)28-18/h1-6,9H,7-8H2,(H2,23,24,26,27) |
| InChIKey | QWPYJFSTZBRDMY-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|