C24H27N3O4 — CID 10740866
3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-8-methoxy-1H-quinazoline-2,4-dione (PubChem CID 10740866) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-8-methoxy-1H-quinazoline-2,4-dione.
| Compound Name | 3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-8-methoxy-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 10740866 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-8-methoxy-1H-quinazoline-2,4-dione |
| SMILES | COc1cccc2c1CC[C@H]1CN(CCn3c(=O)[nH]c4c(OC)cccc4c3=O)C[C@@H]21 |
| InChI | InChI=1S/C24H27N3O4/c1-30-20-7-3-5-16-17(20)10-9-15-13-26(14-19(15)16)11-12-27-23(28)18-6-4-8-21(31-2)22(18)25-24(27)29/h3-8,15,19H,9-14H2,1-2H3,(H,25,29)/t15-,19+/m0/s1 |
| InChIKey | KKPIEWMOXUDHDQ-HNAYVOBHSA-N |
| XLogP | 2.37 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |