C8H7FN4O2 — CID 107409356
4-(3-amino-5-fluorophenyl)-1,2,4-triazolidine-3,5-dione (PubChem CID 107409356) has the molecular formula C8H7FN4O2 and a molecular weight of 210.17 g/mol. Its IUPAC name is 4-(3-amino-5-fluorophenyl)-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-(3-amino-5-fluorophenyl)-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 107409356 |
| Molecular Formula | C8H7FN4O2 |
| Molecular Weight | 210.17 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 4-(3-amino-5-fluorophenyl)-1,2,4-triazolidine-3,5-dione |
| SMILES | Nc1cc(F)cc(-n2c(=O)[nH][nH]c2=O)c1 |
| InChI | InChI=1S/C8H7FN4O2/c9-4-1-5(10)3-6(2-4)13-7(14)11-12-8(13)15/h1-3H,10H2,(H,11,14)(H,12,15) |
| InChIKey | XNTNIPJORGSDBM-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.17 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|