C8H11N5O2 — CID 107409796
4-[3-(1H-imidazol-2-yl)propyl]-1,2,4-triazolidine-3,5-dione (PubChem CID 107409796) has the molecular formula C8H11N5O2 and a molecular weight of 209.21 g/mol. Its IUPAC name is 4-[3-(1H-imidazol-2-yl)propyl]-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-[3-(1H-imidazol-2-yl)propyl]-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 107409796 |
| Molecular Formula | C8H11N5O2 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 4-[3-(1H-imidazol-2-yl)propyl]-1,2,4-triazolidine-3,5-dione |
| SMILES | O=c1[nH][nH]c(=O)n1CCCc1ncc[nH]1 |
| InChI | InChI=1S/C8H11N5O2/c14-7-11-12-8(15)13(7)5-1-2-6-9-3-4-10-6/h3-4H,1-2,5H2,(H,9,10)(H,11,14)(H,12,15) |
| InChIKey | HTNPDQCSQRNMAZ-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |