C20H24O10 — CID 10740985
dimethyl (1S,2S,7S,8S)-6,6,12,12-tetramethoxy-5,11-dioxotricyclo[6.2.2.02,7]dodeca-3,9-diene-2,9-dicarboxylate (PubChem CID 10740985) has the molecular formula C20H24O10 and a molecular weight of 424.40 g/mol. Its IUPAC name is dimethyl (1S,2S,7S,8S)-6,6,12,12-tetramethoxy-5,11-dioxotricyclo[6.2.2.02,7]dodeca-3,9-diene-2,9-dicarboxylate.
| Compound Name | dimethyl (1S,2S,7S,8S)-6,6,12,12-tetramethoxy-5,11-dioxotricyclo[6.2.2.02,7]dodeca-3,9-diene-2,9-dicarboxylate |
|---|---|
| PubChem CID | 10740985 |
| Molecular Formula | C20H24O10 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | dimethyl (1S,2S,7S,8S)-6,6,12,12-tetramethoxy-5,11-dioxotricyclo[6.2.2.02,7]dodeca-3,9-diene-2,9-dicarboxylate |
| SMILES | COC(=O)C1=C[C@@H]2C(=O)C(OC)(OC)[C@H]1[C@@H]1C(OC)(OC)C(=O)C=C[C@]21C(=O)OC |
| InChI | InChI=1S/C20H24O10/c1-25-16(23)10-9-11-15(22)20(29-5,30-6)13(10)14-18(11,17(24)26-2)8-7-12(21)19(14,27-3)28-4/h7-9,11,13-14H,1-6H3/t11-,13-,14+,18+/m1/s1 |
| InChIKey | UHTKNCBLGVEEQP-IUWMUCMRSA-N |
| XLogP | -0.19 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|