C9H17N3O3 — CID 107409948
4-(2-hydroxy-2,4-dimethylpentyl)-1,2,4-triazolidine-3,5-dione (PubChem CID 107409948) has the molecular formula C9H17N3O3 and a molecular weight of 215.25 g/mol. Its IUPAC name is 4-(2-hydroxy-2,4-dimethylpentyl)-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-(2-hydroxy-2,4-dimethylpentyl)-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 107409948 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 4-(2-hydroxy-2,4-dimethylpentyl)-1,2,4-triazolidine-3,5-dione |
| SMILES | CC(C)CC(C)(O)Cn1c(=O)[nH][nH]c1=O |
| InChI | InChI=1S/C9H17N3O3/c1-6(2)4-9(3,15)5-12-7(13)10-11-8(12)14/h6,15H,4-5H2,1-3H3,(H,10,13)(H,11,14) |
| InChIKey | QOKXIWRLPRKSOY-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |