C7H13N3O3 — CID 107409971
4-(3-hydroxypentyl)-1,2,4-triazolidine-3,5-dione (PubChem CID 107409971) has the molecular formula C7H13N3O3 and a molecular weight of 187.20 g/mol. Its IUPAC name is 4-(3-hydroxypentyl)-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-(3-hydroxypentyl)-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 107409971 |
| Molecular Formula | C7H13N3O3 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 4-(3-hydroxypentyl)-1,2,4-triazolidine-3,5-dione |
| SMILES | CCC(O)CCn1c(=O)[nH][nH]c1=O |
| InChI | InChI=1S/C7H13N3O3/c1-2-5(11)3-4-10-6(12)8-9-7(10)13/h5,11H,2-4H2,1H3,(H,8,12)(H,9,13) |
| InChIKey | BSGISGTUWGRTDE-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |