C5H8N4O2 — CID 107409987
4-(2-aminocyclopropyl)-1,2,4-triazolidine-3,5-dione (PubChem CID 107409987) has the molecular formula C5H8N4O2 and a molecular weight of 156.14 g/mol. Its IUPAC name is 4-(2-aminocyclopropyl)-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-(2-aminocyclopropyl)-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 107409987 |
| Molecular Formula | C5H8N4O2 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 4-(2-aminocyclopropyl)-1,2,4-triazolidine-3,5-dione |
| SMILES | NC1CC1n1c(=O)[nH][nH]c1=O |
| InChI | InChI=1S/C5H8N4O2/c6-2-1-3(2)9-4(10)7-8-5(9)11/h2-3H,1,6H2,(H,7,10)(H,8,11) |
| InChIKey | PSDMXYOSKKZQBO-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |