About 4-(hydroxymethyl)-2,6-dimethoxyphenol
4-(hydroxymethyl)-2,6-dimethoxyphenol (PubChem CID 10741) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is 4-(hydroxymethyl)-2,6-dimethoxyphenol.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)-2,6-dimethoxyphenol |
| PubChem CID | 10741 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 4-(hydroxymethyl)-2,6-dimethoxyphenol |
| SMILES | COc1cc(CO)cc(OC)c1O |
| InChI | InChI=1S/C9H12O4/c1-12-7-3-6(5-10)4-8(13-2)9(7)11/h3-4,10-11H,5H2,1-2H3 |
| InChIKey | LUOAEJWSKPQLJD-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(hydroxymethyl)-2,6-dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)-2,6-dimethoxyphenol?
The IUPAC name of 4-(hydroxymethyl)-2,6-dimethoxyphenol (CID 10741) is 4-(hydroxymethyl)-2,6-dimethoxyphenol.
What is the SMILES notation for 4-(hydroxymethyl)-2,6-dimethoxyphenol?
The canonical SMILES for 4-(hydroxymethyl)-2,6-dimethoxyphenol is COc1cc(CO)cc(OC)c1O.
What is the InChIKey of 4-(hydroxymethyl)-2,6-dimethoxyphenol?
The InChIKey is LUOAEJWSKPQLJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c1-12-7-3-6(5-10)4-8(13-2)9(7)11/h3-4,10-11H,5H2,1-2H3.
What are the key properties of 4-(hydroxymethyl)-2,6-dimethoxyphenol?
4-(hydroxymethyl)-2,6-dimethoxyphenol has a molecular weight of 184.19 g/mol, XLogP of 0.90, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-2,6-dimethoxyphenol is sourced from PubChem (CID 10741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).