C5H10N4O2 — CID 107410008
4-[2-(methylamino)ethyl]-1,2,4-triazolidine-3,5-dione (PubChem CID 107410008) has the molecular formula C5H10N4O2 and a molecular weight of 158.16 g/mol. Its IUPAC name is 4-[2-(methylamino)ethyl]-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-[2-(methylamino)ethyl]-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 107410008 |
| Molecular Formula | C5H10N4O2 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 4-[2-(methylamino)ethyl]-1,2,4-triazolidine-3,5-dione |
| SMILES | CNCCn1c(=O)[nH][nH]c1=O |
| InChI | InChI=1S/C5H10N4O2/c1-6-2-3-9-4(10)7-8-5(9)11/h6H,2-3H2,1H3,(H,7,10)(H,8,11) |
| InChIKey | VVBJQRULLZODIK-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |