C7H14N4O2 — CID 107410010
4-[2-(propylamino)ethyl]-1,2,4-triazolidine-3,5-dione (PubChem CID 107410010) has the molecular formula C7H14N4O2 and a molecular weight of 186.21 g/mol. Its IUPAC name is 4-[2-(propylamino)ethyl]-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-[2-(propylamino)ethyl]-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 107410010 |
| Molecular Formula | C7H14N4O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | 4-[2-(propylamino)ethyl]-1,2,4-triazolidine-3,5-dione |
| SMILES | CCCNCCn1c(=O)[nH][nH]c1=O |
| InChI | InChI=1S/C7H14N4O2/c1-2-3-8-4-5-11-6(12)9-10-7(11)13/h8H,2-5H2,1H3,(H,9,12)(H,10,13) |
| InChIKey | GKPDMQBOYRVSON-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|